C6H7BF3NO6 — CID 158407453
boric acid;3,4-dihydroxy-5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 158407453) has the molecular formula C6H7BF3NO6 and a molecular weight of 256.93 g/mol. Its IUPAC name is boric acid;3,4-dihydroxy-5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | boric acid;3,4-dihydroxy-5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 158407453 |
| Molecular Formula | C6H7BF3NO6 |
| Molecular Weight | 256.93 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | boric acid;3,4-dihydroxy-5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C(F)(F)F)c(O)c1O.OB(O)O |
| InChI | InChI=1S/C6H4F3NO3.BH3O3/c7-6(8,9)2-1-10-5(13)4(12)3(2)11;2-1(3)4/h1,12H,(H2,10,11,13);2-4H |
| InChIKey | GYWMBZDDXLGLDH-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.93 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|