About 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone
1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone (PubChem CID 158409086) has the molecular formula C26H40O4
and a molecular weight of 416.60 g/mol. Its IUPAC name is 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone |
| PubChem CID | 158409086 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone |
| SMILES | COC1(C(C)(C)C)C=CC(C(C)=O)=CC1.COC1(C(C)(C)C)C=CC(C(C)=O)=CC1 |
| InChI | InChI=1S/2C13H20O2/c2*1-10(14)11-6-8-13(15-5,9-7-11)12(2,3)4/h2*6-8H,9H2,1-5H3 |
| InChIKey | GZBNQHMZVCVXHK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone?
The IUPAC name of 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone (CID 158409086) is 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone.
What is the SMILES notation for 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone?
The canonical SMILES for 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone is COC1(C(C)(C)C)C=CC(C(C)=O)=CC1.COC1(C(C)(C)C)C=CC(C(C)=O)=CC1.
What is the InChIKey of 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone?
The InChIKey is GZBNQHMZVCVXHK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H20O2/c2*1-10(14)11-6-8-13(15-5,9-7-11)12(2,3)4/h2*6-8H,9H2,1-5H3.
What are the key properties of 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone?
1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone has a molecular weight of 416.60 g/mol, XLogP of 5.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-4-methoxycyclohexa-1,5-dien-1-yl)ethanone is sourced from PubChem (CID 158409086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).