C29H42O3 — CID 173465084
(4E,7E)-2-(6-methoxycyclohexa-1,3-dien-1-yl)-10-(6-methoxycyclohexa-2,4-dien-1-yl)-2,5,7,10-tetramethylundeca-4,7-dien-6-one (PubChem CID 173465084) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is (4E,7E)-2-(6-methoxycyclohexa-1,3-dien-1-yl)-10-(6-methoxycyclohexa-2,4-dien-1-yl)-2,5,7,10-tetramethylundeca-4,7-dien-6-one.
| Compound Name | (4E,7E)-2-(6-methoxycyclohexa-1,3-dien-1-yl)-10-(6-methoxycyclohexa-2,4-dien-1-yl)-2,5,7,10-tetramethylundeca-4,7-dien-6-one |
|---|---|
| PubChem CID | 173465084 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | (4E,7E)-2-(6-methoxycyclohexa-1,3-dien-1-yl)-10-(6-methoxycyclohexa-2,4-dien-1-yl)-2,5,7,10-tetramethylundeca-4,7-dien-6-one |
| SMILES | COC1CC=CC=C1C(C)(C)C/C=C(\C)C(=O)/C(C)=C/CC(C)(C)C1C=CC=CC1OC |
| InChI | InChI=1S/C29H42O3/c1-21(17-19-28(3,4)23-13-9-11-15-25(23)31-7)27(30)22(2)18-20-29(5,6)24-14-10-12-16-26(24)32-8/h9-15,17-18,23,25-26H,16,19-20H2,1-8H3/b21-17+,22-18+ |
| InChIKey | RWZWWJUCTQEARS-KSTNYAOJSA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|