About 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid
5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid (PubChem CID 158410217) has the molecular formula C23H37N3O2S
and a molecular weight of 419.64 g/mol. Its IUPAC name is 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid.
Molecular Properties
| Compound Name | 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid |
| PubChem CID | 158410217 |
| Molecular Formula | C23H37N3O2S |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid |
| SMILES | CCCCCCCCCC(=O)S.Cc1ccccc1-c1c(N)[nH]n(C(C)C)c1=O |
| InChI | InChI=1S/C13H17N3O.C10H20OS/c1-8(2)16-13(17)11(12(14)15-16)10-7-5-4-6-9(10)3;1-2-3-4-5-6-7-8-9-10(11)12/h4-8,15H,14H2,1-3H3;2-9H2,1H3,(H,11,12) |
| InChIKey | GZFFRYKUUBZUSG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid?
The IUPAC name of 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid (CID 158410217) is 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid.
What is the SMILES notation for 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid?
The canonical SMILES for 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid is CCCCCCCCCC(=O)S.Cc1ccccc1-c1c(N)[nH]n(C(C)C)c1=O.
What is the InChIKey of 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid?
The InChIKey is GZFFRYKUUBZUSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O.C10H20OS/c1-8(2)16-13(17)11(12(14)15-16)10-7-5-4-6-9(10)3;1-2-3-4-5-6-7-8-9-10(11)12/h4-8,15H,14H2,1-3H3;2-9H2,1H3,(H,11,12).
What are the key properties of 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid?
5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid has a molecular weight of 419.64 g/mol, XLogP of 5.90, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(2-methylphenyl)-2-propan-2-yl-1H-pyrazol-3-one;decanethioic S-acid is sourced from PubChem (CID 158410217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).