C43H53N5O9 — CID 158411069
(3S)-3-[3-[6-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-2-yl]phenyl]-6-[5-(4-methyl-2-pyridinyl)pentanoylamino]-5-oxohexanoic acid (PubChem CID 158411069) has the molecular formula C43H53N5O9 and a molecular weight of 783.92 g/mol. Its IUPAC name is (3S)-3-[3-[6-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-2-yl]phenyl]-6-[5-(4-methyl-2-pyridinyl)pentanoylamino]-5-oxohexanoic acid.
| Compound Name | (3S)-3-[3-[6-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-2-yl]phenyl]-6-[5-(4-methyl-2-pyridinyl)pentanoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 158411069 |
| Molecular Formula | C43H53N5O9 |
| Molecular Weight | 783.92 g/mol |
| Exact Mass | 783.38 |
| IUPAC Name | (3S)-3-[3-[6-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-2-yl]phenyl]-6-[5-(4-methyl-2-pyridinyl)pentanoylamino]-5-oxohexanoic acid |
| SMILES | Cc1ccnc(CCCCC(=O)NCC(=O)C[C@@H](CC(=O)O)c2cccc(-c3ccc4cc(OCCOCCOCCOCCOCCN=[N+]=[N-])ccc4c3)c2)c1 |
| InChI | InChI=1S/C43H53N5O9/c1-32-13-14-45-39(25-32)7-2-3-8-42(50)46-31-40(49)28-38(30-43(51)52)34-6-4-5-33(26-34)35-9-10-37-29-41(12-11-36(37)27-35)57-24-23-56-22-21-55-20-19-54-18-17-53-16-15-47-48-44/h4-6,9-14,25-27,29,38H,2-3,7-8,15-24,28,30-31H2,1H3,(H,46,50)(H,51,52)/t38-/m0/s1 |
| InChIKey | LENBCEDMZHLDHY-LHEWISCISA-N |
| XLogP | 7.01 |
| TPSA | 191.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.92 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|