C42H52N2O7 — CID 161088763
(3S)-3-[4-[4-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]naphthalen-1-yl]phenyl]-6-[5-(4-methyl-2-pyridinyl)pentanoylamino]-5-oxohexanoic acid (PubChem CID 161088763) has the molecular formula C42H52N2O7 and a molecular weight of 696.89 g/mol. Its IUPAC name is (3S)-3-[4-[4-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]naphthalen-1-yl]phenyl]-6-[5-(4-methyl-2-pyridinyl)pentanoylamino]-5-oxohexanoic acid.
| Compound Name | (3S)-3-[4-[4-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]naphthalen-1-yl]phenyl]-6-[5-(4-methyl-2-pyridinyl)pentanoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 161088763 |
| Molecular Formula | C42H52N2O7 |
| Molecular Weight | 696.89 g/mol |
| Exact Mass | 696.38 |
| IUPAC Name | (3S)-3-[4-[4-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]naphthalen-1-yl]phenyl]-6-[5-(4-methyl-2-pyridinyl)pentanoylamino]-5-oxohexanoic acid |
| SMILES | Cc1ccnc(CCCCC(=O)NCC(=O)C[C@@H](CC(=O)O)c2ccc(-c3ccc(OCCOCCOCCC(C)C)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C42H52N2O7/c1-30(2)19-21-49-22-23-50-24-25-51-40-17-16-37(38-9-5-6-10-39(38)40)33-14-12-32(13-15-33)34(28-42(47)48)27-36(45)29-44-41(46)11-7-4-8-35-26-31(3)18-20-43-35/h5-6,9-10,12-18,20,26,30,34H,4,7-8,11,19,21-25,27-29H2,1-3H3,(H,44,46)(H,47,48)/t34-/m0/s1 |
| InChIKey | UGWQFGFERCIGJB-UMSFTDKQSA-N |
| XLogP | 7.72 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.89 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|