C17H17N3O2 — CID 158415584
4-(oxan-2-yl)-4,5,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaen-7-ol (PubChem CID 158415584) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-(oxan-2-yl)-4,5,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaen-7-ol.
| Compound Name | 4-(oxan-2-yl)-4,5,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaen-7-ol |
|---|---|
| PubChem CID | 158415584 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-(oxan-2-yl)-4,5,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaen-7-ol |
| SMILES | OC1C2=CCc3nccc(c32)-c2cn(C3CCCCO3)nc21 |
| InChI | InChI=1S/C17H17N3O2/c21-17-11-4-5-13-15(11)10(6-7-18-13)12-9-20(19-16(12)17)14-3-1-2-8-22-14/h4,6-7,9,14,17,21H,1-3,5,8H2 |
| InChIKey | MIYVYGXPKVYPFN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |