About CID 158416188
CID 158416188 (PubChem CID 158416188) has the molecular formula C58H37BCl3N6O2
and a molecular weight of 967.15 g/mol.
Molecular Properties
| Compound Name | CID 158416188 |
| PubChem CID | 158416188 |
| Molecular Formula | C58H37BCl3N6O2 |
| Molecular Weight | 967.15 g/mol |
| Exact Mass | 965.21 |
| IUPAC Name | — |
| SMILES | Clc1nc(-c2cccc(-c3cccc4ccccc34)c2)nc(-c2cccc3ccccc23)n1.Clc1nc(Cl)nc(-c2cccc3ccccc23)n1.O[B]Oc1cccc(-c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C29H18ClN3.C16H12BO2.C13H7Cl2N3/c30-29-32-27(31-28(33-29)26-17-7-11-20-9-2-4-15-24(20)26)22-13-5-12-21(18-22)25-16-6-10-19-8-1-3-14-23(19)25;18-17-19-14-8-3-7-13(11-14)16-10-4-6-12-5-1-2-9-15(12)16;14-12-16-11(17-13(15)18-12)10-7-3-5-8-4-1-2-6-9(8)10/h1-18H;1-11,18H;1-7H |
| InChIKey | YQYLKYCKVKTLKD-UHFFFAOYSA-N |
| XLogP | 15.24 |
| TPSA | 106.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 967.15 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158416188 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158416188?
The IUPAC name of CID 158416188 (CID 158416188) is not available.
What is the SMILES notation for CID 158416188?
The canonical SMILES for CID 158416188 is Clc1nc(-c2cccc(-c3cccc4ccccc34)c2)nc(-c2cccc3ccccc23)n1.Clc1nc(Cl)nc(-c2cccc3ccccc23)n1.O[B]Oc1cccc(-c2cccc3ccccc23)c1.
What is the InChIKey of CID 158416188?
The InChIKey is YQYLKYCKVKTLKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H18ClN3.C16H12BO2.C13H7Cl2N3/c30-29-32-27(31-28(33-29)26-17-7-11-20-9-2-4-15-24(20)26)22-13-5-12-21(18-22)25-16-6-10-19-8-1-3-14-23(19)25;18-17-19-14-8-3-7-13(11-14)16-10-4-6-12-5-1-2-9-15(12)16;14-12-16-11(17-13(15)18-12)10-7-3-5-8-4-1-2-6-9(8)10/h1-18H;1-11,18H;1-7H.
What are the key properties of CID 158416188?
CID 158416188 has a molecular weight of 967.15 g/mol, XLogP of 15.24, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158416188 is sourced from PubChem (CID 158416188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).