About CID 161032675
CID 161032675 (PubChem CID 161032675) has the molecular formula C62H41BCl3N6O2
and a molecular weight of 1019.22 g/mol.
Molecular Properties
| Compound Name | CID 161032675 |
| PubChem CID | 161032675 |
| Molecular Formula | C62H41BCl3N6O2 |
| Molecular Weight | 1019.22 g/mol |
| Exact Mass | 1017.24 |
| IUPAC Name | — |
| SMILES | Clc1nc(-c2ccc3cc(-c4ccccc4)ccc3c2)nc(-c2ccccc2-c2ccccc2)n1.Clc1nc(Cl)nc(-c2ccccc2-c2ccccc2)n1.O[B]Oc1ccc2cc(-c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C31H20ClN3.C16H12BO2.C15H9Cl2N3/c32-31-34-29(33-30(35-31)28-14-8-7-13-27(28)22-11-5-2-6-12-22)26-18-17-24-19-23(15-16-25(24)20-26)21-9-3-1-4-10-21;18-17-19-16-9-8-14-10-13(6-7-15(14)11-16)12-4-2-1-3-5-12;16-14-18-13(19-15(17)20-14)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-20H;1-11,18H;1-9H |
| InChIKey | FOFGTJWVEPWTKS-UHFFFAOYSA-N |
| XLogP | 16.27 |
| TPSA | 106.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1019.22 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 161032675 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161032675?
The IUPAC name of CID 161032675 (CID 161032675) is not available.
What is the SMILES notation for CID 161032675?
The canonical SMILES for CID 161032675 is Clc1nc(-c2ccc3cc(-c4ccccc4)ccc3c2)nc(-c2ccccc2-c2ccccc2)n1.Clc1nc(Cl)nc(-c2ccccc2-c2ccccc2)n1.O[B]Oc1ccc2cc(-c3ccccc3)ccc2c1.
What is the InChIKey of CID 161032675?
The InChIKey is FOFGTJWVEPWTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H20ClN3.C16H12BO2.C15H9Cl2N3/c32-31-34-29(33-30(35-31)28-14-8-7-13-27(28)22-11-5-2-6-12-22)26-18-17-24-19-23(15-16-25(24)20-26)21-9-3-1-4-10-21;18-17-19-16-9-8-14-10-13(6-7-15(14)11-16)12-4-2-1-3-5-12;16-14-18-13(19-15(17)20-14)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-20H;1-11,18H;1-9H.
What are the key properties of CID 161032675?
CID 161032675 has a molecular weight of 1019.22 g/mol, XLogP of 16.27, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161032675 is sourced from PubChem (CID 161032675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).