C25H17BN3O2 — CID 170776693
CID 170776693 (PubChem CID 170776693) has the molecular formula C25H17BN3O2 and a molecular weight of 402.24 g/mol.
| Compound Name | CID 170776693 |
|---|---|
| PubChem CID | 170776693 |
| Molecular Formula | C25H17BN3O2 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccccc1-c1nc(-c2ccccc2)nc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C25H17BN3O2/c30-26-31-22-13-7-6-12-21(22)25-28-23(18-9-2-1-3-10-18)27-24(29-25)20-15-14-17-8-4-5-11-19(17)16-20/h1-16,30H |
| InChIKey | PXUXBTJNBSHBLP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|