C17H21N3O — CID 158416531
(3-amino-4,5,6,7-tetrahydroindazol-2-yl)-(4,5,6,7-tetrahydro-1H-inden-4-yl)methanone (PubChem CID 158416531) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is (3-amino-4,5,6,7-tetrahydroindazol-2-yl)-(4,5,6,7-tetrahydro-1H-inden-4-yl)methanone.
| Compound Name | (3-amino-4,5,6,7-tetrahydroindazol-2-yl)-(4,5,6,7-tetrahydro-1H-inden-4-yl)methanone |
|---|---|
| PubChem CID | 158416531 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (3-amino-4,5,6,7-tetrahydroindazol-2-yl)-(4,5,6,7-tetrahydro-1H-inden-4-yl)methanone |
| SMILES | Nc1c2c(nn1C(=O)C1CCCC3=C1C=CC3)CCCC2 |
| InChI | InChI=1S/C17H21N3O/c18-16-14-7-1-2-10-15(14)19-20(16)17(21)13-9-4-6-11-5-3-8-12(11)13/h3,8,13H,1-2,4-7,9-10,18H2 |
| InChIKey | DYIARYPWTBCKDU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |