C17H20F2N4O — CID 165081763
(3-amino-5-fluoro-4,5,6,7-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4,4a,8a-hexahydroquinolin-4-yl)methanone (PubChem CID 165081763) has the molecular formula C17H20F2N4O and a molecular weight of 334.37 g/mol. Its IUPAC name is (3-amino-5-fluoro-4,5,6,7-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4,4a,8a-hexahydroquinolin-4-yl)methanone.
| Compound Name | (3-amino-5-fluoro-4,5,6,7-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4,4a,8a-hexahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 165081763 |
| Molecular Formula | C17H20F2N4O |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (3-amino-5-fluoro-4,5,6,7-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4,4a,8a-hexahydroquinolin-4-yl)methanone |
| SMILES | Nc1c2c(nn1C(=O)C1CCNC3C=CC(F)=CC31)CCC(F)C2 |
| InChI | InChI=1S/C17H20F2N4O/c18-9-1-3-14-12(7-9)11(5-6-21-14)17(24)23-16(20)13-8-10(19)2-4-15(13)22-23/h1,3,7,10-12,14,21H,2,4-6,8,20H2 |
| InChIKey | VFXPEBOLDNUIQK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |