C18H32O5 — CID 15841979
(Z)-12-(5-ethyloxolan-2-yl)-7,12-dihydroxydodec-9-enoic acid (PubChem CID 15841979) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (Z)-12-(5-ethyloxolan-2-yl)-7,12-dihydroxydodec-9-enoic acid.
| Compound Name | (Z)-12-(5-ethyloxolan-2-yl)-7,12-dihydroxydodec-9-enoic acid |
|---|---|
| PubChem CID | 15841979 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (Z)-12-(5-ethyloxolan-2-yl)-7,12-dihydroxydodec-9-enoic acid |
| SMILES | CCC1CCC(C(O)C/C=C\CC(O)CCCCCC(=O)O)O1 |
| InChI | InChI=1S/C18H32O5/c1-2-15-12-13-17(23-15)16(20)10-7-6-9-14(19)8-4-3-5-11-18(21)22/h6-7,14-17,19-20H,2-5,8-13H2,1H3,(H,21,22)/b7-6- |
| InChIKey | XJBRLNHWKVUEAW-SREVYHEPSA-N |
| XLogP | 3.04 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|