C32H61BN4O8 — CID 158432019
[(2R,5S)-9-amino-5-[[(2R,5S,6R)-5-[[(2R)-2-(2-aminoethyl)-4-oxotridecanoyl]amino]-6-hydroxy-2-methyl-4-oxoheptanoyl]amino]-4-oxononan-2-yl]boronic acid (PubChem CID 158432019) has the molecular formula C32H61BN4O8 and a molecular weight of 640.67 g/mol. Its IUPAC name is [(2R,5S)-9-amino-5-[[(2R,5S,6R)-5-[[(2R)-2-(2-aminoethyl)-4-oxotridecanoyl]amino]-6-hydroxy-2-methyl-4-oxoheptanoyl]amino]-4-oxononan-2-yl]boronic acid.
| Compound Name | [(2R,5S)-9-amino-5-[[(2R,5S,6R)-5-[[(2R)-2-(2-aminoethyl)-4-oxotridecanoyl]amino]-6-hydroxy-2-methyl-4-oxoheptanoyl]amino]-4-oxononan-2-yl]boronic acid |
|---|---|
| PubChem CID | 158432019 |
| Molecular Formula | C32H61BN4O8 |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 640.46 |
| IUPAC Name | [(2R,5S)-9-amino-5-[[(2R,5S,6R)-5-[[(2R)-2-(2-aminoethyl)-4-oxotridecanoyl]amino]-6-hydroxy-2-methyl-4-oxoheptanoyl]amino]-4-oxononan-2-yl]boronic acid |
| SMILES | CCCCCCCCCC(=O)C[C@@H](CCN)C(=O)N[C@H](C(=O)C[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)C[C@@H](C)B(O)O)[C@@H](C)O |
| InChI | InChI=1S/C32H61BN4O8/c1-5-6-7-8-9-10-11-14-26(39)21-25(16-18-35)32(43)37-30(24(4)38)29(41)19-22(2)31(42)36-27(15-12-13-17-34)28(40)20-23(3)33(44)45/h22-25,27,30,38,44-45H,5-21,34-35H2,1-4H3,(H,36,42)(H,37,43)/t22-,23-,24-,25-,27+,30+/m1/s1 |
| InChIKey | LZVJWSMLQQNVQZ-BGXTVQOYSA-N |
| XLogP | 1.95 |
| TPSA | 222.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|