C36H62N4O9 — CID 160838446
(2R)-2-(4-aminobutyl)-N-[(3S,6R)-7-[[(3S)-1-amino-6-methyl-1,4,7,8-tetraoxodecan-3-yl]amino]-2-hydroxy-6-methyl-4,7-dioxoheptan-3-yl]-4-oxotridecanamide (PubChem CID 160838446) has the molecular formula C36H62N4O9 and a molecular weight of 694.91 g/mol. Its IUPAC name is (2R)-2-(4-aminobutyl)-N-[(3S,6R)-7-[[(3S)-1-amino-6-methyl-1,4,7,8-tetraoxodecan-3-yl]amino]-2-hydroxy-6-methyl-4,7-dioxoheptan-3-yl]-4-oxotridecanamide.
| Compound Name | (2R)-2-(4-aminobutyl)-N-[(3S,6R)-7-[[(3S)-1-amino-6-methyl-1,4,7,8-tetraoxodecan-3-yl]amino]-2-hydroxy-6-methyl-4,7-dioxoheptan-3-yl]-4-oxotridecanamide |
|---|---|
| PubChem CID | 160838446 |
| Molecular Formula | C36H62N4O9 |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 694.45 |
| IUPAC Name | (2R)-2-(4-aminobutyl)-N-[(3S,6R)-7-[[(3S)-1-amino-6-methyl-1,4,7,8-tetraoxodecan-3-yl]amino]-2-hydroxy-6-methyl-4,7-dioxoheptan-3-yl]-4-oxotridecanamide |
| SMILES | CCCCCCCCCC(=O)C[C@@H](CCCCN)C(=O)N[C@H](C(=O)C[C@@H](C)C(=O)N[C@@H](CC(N)=O)C(=O)CC(C)C(=O)C(=O)CC)C(C)O |
| InChI | InChI=1S/C36H62N4O9/c1-6-8-9-10-11-12-13-17-27(42)21-26(16-14-15-18-37)36(49)40-33(25(5)41)31(45)20-24(4)35(48)39-28(22-32(38)46)30(44)19-23(3)34(47)29(43)7-2/h23-26,28,33,41H,6-22,37H2,1-5H3,(H2,38,46)(H,39,48)(H,40,49)/t23?,24-,25?,26-,28+,33+/m1/s1 |
| InChIKey | LYTWGVOJRNJMKK-BZIDBMJOSA-N |
| XLogP | 2.80 |
| TPSA | 232.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|