C25H33N5O3 — CID 158434327
1-[2-[(1R,3S,5R)-3-[2-[(1R)-3,3-dimethylcyclohexyl]acetyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-7-methylpyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 158434327) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-[2-[(1R,3S,5R)-3-[2-[(1R)-3,3-dimethylcyclohexyl]acetyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-7-methylpyrazolo[5,4-c]pyridine-3-carboxamide.
| Compound Name | 1-[2-[(1R,3S,5R)-3-[2-[(1R)-3,3-dimethylcyclohexyl]acetyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-7-methylpyrazolo[5,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158434327 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 1-[2-[(1R,3S,5R)-3-[2-[(1R)-3,3-dimethylcyclohexyl]acetyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-7-methylpyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | Cc1nccc2c(C(N)=O)nn(CC(=O)N3[C@@H]4C[C@@H]4C[C@H]3C(=O)C[C@@H]3CCCC(C)(C)C3)c12 |
| InChI | InChI=1S/C25H33N5O3/c1-14-23-17(6-8-27-14)22(24(26)33)28-29(23)13-21(32)30-18-10-16(18)11-19(30)20(31)9-15-5-4-7-25(2,3)12-15/h6,8,15-16,18-19H,4-5,7,9-13H2,1-3H3,(H2,26,33)/t15-,16+,18+,19-/m0/s1 |
| InChIKey | HCARPIJPKHFKEC-ISARSNTHSA-N |
| XLogP | 3.00 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |