C21H24Cl2N6O3 — CID 90020081
1-[2-[(1R,3S,5R)-3-[[(1R)-2,2-dichlorocyclopropyl]methylcarbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5,7-dimethylpyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 90020081) has the molecular formula C21H24Cl2N6O3 and a molecular weight of 479.37 g/mol. Its IUPAC name is 1-[2-[(1R,3S,5R)-3-[[(1R)-2,2-dichlorocyclopropyl]methylcarbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5,7-dimethylpyrazolo[5,4-c]pyridine-3-carboxamide.
| Compound Name | 1-[2-[(1R,3S,5R)-3-[[(1R)-2,2-dichlorocyclopropyl]methylcarbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5,7-dimethylpyrazolo[5,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90020081 |
| Molecular Formula | C21H24Cl2N6O3 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1-[2-[(1R,3S,5R)-3-[[(1R)-2,2-dichlorocyclopropyl]methylcarbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5,7-dimethylpyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | Cc1cc2c(C(N)=O)nn(CC(=O)N3[C@@H]4C[C@@H]4C[C@H]3C(=O)NC[C@H]3CC3(Cl)Cl)c2c(C)n1 |
| InChI | InChI=1S/C21H24Cl2N6O3/c1-9-3-13-17(19(24)31)27-28(18(13)10(2)26-9)8-16(30)29-14-4-11(14)5-15(29)20(32)25-7-12-6-21(12,22)23/h3,11-12,14-15H,4-8H2,1-2H3,(H2,24,31)(H,25,32)/t11-,12-,14-,15+/m1/s1 |
| InChIKey | ZRSOXRYMLAZAHG-GBOPCIDUSA-N |
| XLogP | 1.45 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|