C25H25Cl2N5O4S — CID 72709394
(1R,3S,5R)-2-[2-[3-acetyl-5-(1,3-thiazol-4-ylmethoxy)indazol-1-yl]acetyl]-N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 72709394) has the molecular formula C25H25Cl2N5O4S and a molecular weight of 562.48 g/mol. Its IUPAC name is (1R,3S,5R)-2-[2-[3-acetyl-5-(1,3-thiazol-4-ylmethoxy)indazol-1-yl]acetyl]-N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5R)-2-[2-[3-acetyl-5-(1,3-thiazol-4-ylmethoxy)indazol-1-yl]acetyl]-N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 72709394 |
| Molecular Formula | C25H25Cl2N5O4S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | (1R,3S,5R)-2-[2-[3-acetyl-5-(1,3-thiazol-4-ylmethoxy)indazol-1-yl]acetyl]-N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CC(=O)c1nn(CC(=O)N2[C@@H]3C[C@@H]3C[C@H]2C(=O)NC[C@H]2CC2(Cl)Cl)c2ccc(OCc3cscn3)cc12 |
| InChI | InChI=1S/C25H25Cl2N5O4S/c1-13(33)23-18-6-17(36-10-16-11-37-12-29-16)2-3-19(18)31(30-23)9-22(34)32-20-4-14(20)5-21(32)24(35)28-8-15-7-25(15,26)27/h2-3,6,11-12,14-15,20-21H,4-5,7-10H2,1H3,(H,28,35)/t14-,15-,20-,21+/m1/s1 |
| InChIKey | BBAPSMUGHAXKCX-LYDRAKHJSA-N |
| XLogP | 3.57 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|