C14H26S4 — CID 158435421
2,5-diethyl-1,4-dithiane;3-(prop-2-enyldisulfanyl)prop-1-ene (PubChem CID 158435421) has the molecular formula C14H26S4 and a molecular weight of 322.63 g/mol. Its IUPAC name is 2,5-diethyl-1,4-dithiane;3-(prop-2-enyldisulfanyl)prop-1-ene.
| Compound Name | 2,5-diethyl-1,4-dithiane;3-(prop-2-enyldisulfanyl)prop-1-ene |
|---|---|
| PubChem CID | 158435421 |
| Molecular Formula | C14H26S4 |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2,5-diethyl-1,4-dithiane;3-(prop-2-enyldisulfanyl)prop-1-ene |
| SMILES | C=CCSSCC=C.CCC1CSC(CC)CS1 |
| InChI | InChI=1S/C8H16S2.C6H10S2/c1-3-7-5-10-8(4-2)6-9-7;1-3-5-7-8-6-4-2/h7-8H,3-6H2,1-2H3;3-4H,1-2,5-6H2 |
| InChIKey | HCDXXGMJPXSWBI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|