C8H13NOS — CID 131227250
(3R,4S)-3-ethyl-4-prop-2-enylsulfanylazetidin-2-one (PubChem CID 131227250) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is (3R,4S)-3-ethyl-4-prop-2-enylsulfanylazetidin-2-one.
| Compound Name | (3R,4S)-3-ethyl-4-prop-2-enylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 131227250 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | (3R,4S)-3-ethyl-4-prop-2-enylsulfanylazetidin-2-one |
| SMILES | C=CCS[C@@H]1NC(=O)[C@H]1CC |
| InChI | InChI=1S/C8H13NOS/c1-3-5-11-8-6(4-2)7(10)9-8/h3,6,8H,1,4-5H2,2H3,(H,9,10)/t6-,8+/m1/s1 |
| InChIKey | WFDLONSCDQPHEN-SVRRBLITSA-N |
| XLogP | 1.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|