C12H17NO5S — CID 15511996
dimethyl (E)-3-[(2R,3S)-3-ethyl-4-oxoazetidin-2-yl]sulfanylpent-2-enedioate (PubChem CID 15511996) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is dimethyl (E)-3-[(2R,3S)-3-ethyl-4-oxoazetidin-2-yl]sulfanylpent-2-enedioate.
| Compound Name | dimethyl (E)-3-[(2R,3S)-3-ethyl-4-oxoazetidin-2-yl]sulfanylpent-2-enedioate |
|---|---|
| PubChem CID | 15511996 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | dimethyl (E)-3-[(2R,3S)-3-ethyl-4-oxoazetidin-2-yl]sulfanylpent-2-enedioate |
| SMILES | CC[C@H]1C(=O)N[C@@H]1S/C(=C/C(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C12H17NO5S/c1-4-8-11(16)13-12(8)19-7(5-9(14)17-2)6-10(15)18-3/h5,8,12H,4,6H2,1-3H3,(H,13,16)/b7-5+/t8-,12+/m0/s1 |
| InChIKey | OMHSGPMONOEYMO-PTWJVPJASA-N |
| XLogP | 0.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|