C12H15NOS — CID 154224083
3-ethyl-4-(4-methylphenyl)sulfanylazetidin-2-one (PubChem CID 154224083) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-ethyl-4-(4-methylphenyl)sulfanylazetidin-2-one.
| Compound Name | 3-ethyl-4-(4-methylphenyl)sulfanylazetidin-2-one |
|---|---|
| PubChem CID | 154224083 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-ethyl-4-(4-methylphenyl)sulfanylazetidin-2-one |
| SMILES | CCC1C(=O)NC1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C12H15NOS/c1-3-10-11(14)13-12(10)15-9-6-4-8(2)5-7-9/h4-7,10,12H,3H2,1-2H3,(H,13,14) |
| InChIKey | RXMRDGWEQDBAKQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |