C12H13NO3S — CID 101446378
S-(4-methylphenyl) (4R,5S)-5-methyl-2-oxo-1,3-oxazolidine-4-carbothioate (PubChem CID 101446378) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is S-(4-methylphenyl) (4R,5S)-5-methyl-2-oxo-1,3-oxazolidine-4-carbothioate.
| Compound Name | S-(4-methylphenyl) (4R,5S)-5-methyl-2-oxo-1,3-oxazolidine-4-carbothioate |
|---|---|
| PubChem CID | 101446378 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | S-(4-methylphenyl) (4R,5S)-5-methyl-2-oxo-1,3-oxazolidine-4-carbothioate |
| SMILES | Cc1ccc(SC(=O)[C@@H]2NC(=O)O[C@H]2C)cc1 |
| InChI | InChI=1S/C12H13NO3S/c1-7-3-5-9(6-4-7)17-11(14)10-8(2)16-12(15)13-10/h3-6,8,10H,1-2H3,(H,13,15)/t8-,10+/m0/s1 |
| InChIKey | GBGDUSFEPGEUTC-WCBMZHEXSA-N |
| XLogP | 2.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|