C20H20N2O4S — CID 12041292
benzyl (4S,5S)-5-methyl-4-(4-methylphenyl)sulfanylcarbonyl-2-oxoimidazolidine-1-carboxylate (PubChem CID 12041292) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is benzyl (4S,5S)-5-methyl-4-(4-methylphenyl)sulfanylcarbonyl-2-oxoimidazolidine-1-carboxylate.
| Compound Name | benzyl (4S,5S)-5-methyl-4-(4-methylphenyl)sulfanylcarbonyl-2-oxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 12041292 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | benzyl (4S,5S)-5-methyl-4-(4-methylphenyl)sulfanylcarbonyl-2-oxoimidazolidine-1-carboxylate |
| SMILES | Cc1ccc(SC(=O)[C@H]2NC(=O)N(C(=O)OCc3ccccc3)[C@H]2C)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-13-8-10-16(11-9-13)27-18(23)17-14(2)22(19(24)21-17)20(25)26-12-15-6-4-3-5-7-15/h3-11,14,17H,12H2,1-2H3,(H,21,24)/t14-,17-/m0/s1 |
| InChIKey | VMONZYNVXFKRSY-YOEHRIQHSA-N |
| XLogP | 3.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|