C21H20N4O5S — CID 10917182
benzyl (1R,2S,6R,7S)-5-(4-methylphenyl)sulfonyl-9-oxo-3,4,5,8-tetrazatricyclo[5.2.1.02,6]dec-3-ene-8-carboxylate (PubChem CID 10917182) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is benzyl (1R,2S,6R,7S)-5-(4-methylphenyl)sulfonyl-9-oxo-3,4,5,8-tetrazatricyclo[5.2.1.02,6]dec-3-ene-8-carboxylate.
| Compound Name | benzyl (1R,2S,6R,7S)-5-(4-methylphenyl)sulfonyl-9-oxo-3,4,5,8-tetrazatricyclo[5.2.1.02,6]dec-3-ene-8-carboxylate |
|---|---|
| PubChem CID | 10917182 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | benzyl (1R,2S,6R,7S)-5-(4-methylphenyl)sulfonyl-9-oxo-3,4,5,8-tetrazatricyclo[5.2.1.02,6]dec-3-ene-8-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2N=N[C@@H]3[C@H]2[C@@H]2C[C@H]3C(=O)N2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N4O5S/c1-13-7-9-15(10-8-13)31(28,29)25-19-17-11-16(18(19)22-23-25)20(26)24(17)21(27)30-12-14-5-3-2-4-6-14/h2-10,16-19H,11-12H2,1H3/t16-,17+,18+,19-/m1/s1 |
| InChIKey | ACWAYTHCQLLBRW-YDZRNGNQSA-N |
| XLogP | 2.67 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |