C26H23N4O6P — CID 101062982
benzyl 3-diphenoxyphosphoryl-9-oxo-3,4,5,8-tetrazatricyclo[5.2.1.02,6]dec-4-ene-8-carboxylate (PubChem CID 101062982) has the molecular formula C26H23N4O6P and a molecular weight of 518.47 g/mol. Its IUPAC name is benzyl 3-diphenoxyphosphoryl-9-oxo-3,4,5,8-tetrazatricyclo[5.2.1.02,6]dec-4-ene-8-carboxylate.
| Compound Name | benzyl 3-diphenoxyphosphoryl-9-oxo-3,4,5,8-tetrazatricyclo[5.2.1.02,6]dec-4-ene-8-carboxylate |
|---|---|
| PubChem CID | 101062982 |
| Molecular Formula | C26H23N4O6P |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | benzyl 3-diphenoxyphosphoryl-9-oxo-3,4,5,8-tetrazatricyclo[5.2.1.02,6]dec-4-ene-8-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C(=O)C2CC1C1N=NN(P(=O)(Oc3ccccc3)Oc3ccccc3)C21 |
| InChI | InChI=1S/C26H23N4O6P/c31-25-21-16-22(29(25)26(32)34-17-18-10-4-1-5-11-18)23-24(21)30(28-27-23)37(33,35-19-12-6-2-7-13-19)36-20-14-8-3-9-15-20/h1-15,21-24H,16-17H2 |
| InChIKey | IPBYCWNFSNDAPO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 110.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|