C23H29NO — CID 11013097
(2R,3S,5R,6S)-3,5-diethyl-2,6-bis(4-methylphenyl)piperidin-4-one (PubChem CID 11013097) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (2R,3S,5R,6S)-3,5-diethyl-2,6-bis(4-methylphenyl)piperidin-4-one.
| Compound Name | (2R,3S,5R,6S)-3,5-diethyl-2,6-bis(4-methylphenyl)piperidin-4-one |
|---|---|
| PubChem CID | 11013097 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (2R,3S,5R,6S)-3,5-diethyl-2,6-bis(4-methylphenyl)piperidin-4-one |
| SMILES | CC[C@@H]1C(=O)[C@H](CC)[C@@H](c2ccc(C)cc2)N[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H29NO/c1-5-19-21(17-11-7-15(3)8-12-17)24-22(20(6-2)23(19)25)18-13-9-16(4)10-14-18/h7-14,19-22,24H,5-6H2,1-4H3/t19-,20+,21-,22+ |
| InChIKey | PTMUHDUTOLVVSH-COPRSSIGSA-N |
| XLogP | 5.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |