C29H37NO3 — CID 10939259
ethyl 2-[[(2R,3S,5R,6S)-3,5-diethyl-2,6-bis(4-methylphenyl)-4-oxopiperidin-1-yl]methyl]prop-2-enoate (PubChem CID 10939259) has the molecular formula C29H37NO3 and a molecular weight of 447.62 g/mol. Its IUPAC name is ethyl 2-[[(2R,3S,5R,6S)-3,5-diethyl-2,6-bis(4-methylphenyl)-4-oxopiperidin-1-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[(2R,3S,5R,6S)-3,5-diethyl-2,6-bis(4-methylphenyl)-4-oxopiperidin-1-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 10939259 |
| Molecular Formula | C29H37NO3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | ethyl 2-[[(2R,3S,5R,6S)-3,5-diethyl-2,6-bis(4-methylphenyl)-4-oxopiperidin-1-yl]methyl]prop-2-enoate |
| SMILES | C=C(CN1[C@H](c2ccc(C)cc2)[C@@H](CC)C(=O)[C@@H](CC)[C@@H]1c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C29H37NO3/c1-7-24-26(22-14-10-19(4)11-15-22)30(18-21(6)29(32)33-9-3)27(25(8-2)28(24)31)23-16-12-20(5)13-17-23/h10-17,24-27H,6-9,18H2,1-5H3/t24-,25+,26-,27+ |
| InChIKey | AAVODLTYDIKQLE-IAFDGEETSA-N |
| XLogP | 6.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|