C17H23NO3 — CID 169115038
ethyl 2-[5-methyl-2-(4-methylphenyl)piperidin-1-yl]-2-oxoacetate (PubChem CID 169115038) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl 2-[5-methyl-2-(4-methylphenyl)piperidin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[5-methyl-2-(4-methylphenyl)piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169115038 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl 2-[5-methyl-2-(4-methylphenyl)piperidin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CC(C)CCC1c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-4-21-17(20)16(19)18-11-13(3)7-10-15(18)14-8-5-12(2)6-9-14/h5-6,8-9,13,15H,4,7,10-11H2,1-3H3 |
| InChIKey | FROPONUVGIFLTI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|