C16H16F6N2O3 — CID 169113074
2,2,2-trifluoroethyl 2-[5-methyl-2-[5-(trifluoromethyl)-3-pyridinyl]piperidin-1-yl]-2-oxoacetate (PubChem CID 169113074) has the molecular formula C16H16F6N2O3 and a molecular weight of 398.30 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[5-methyl-2-[5-(trifluoromethyl)-3-pyridinyl]piperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[5-methyl-2-[5-(trifluoromethyl)-3-pyridinyl]piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169113074 |
| Molecular Formula | C16H16F6N2O3 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[5-methyl-2-[5-(trifluoromethyl)-3-pyridinyl]piperidin-1-yl]-2-oxoacetate |
| SMILES | CC1CCC(c2cncc(C(F)(F)F)c2)N(C(=O)C(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C16H16F6N2O3/c1-9-2-3-12(10-4-11(6-23-5-10)16(20,21)22)24(7-9)13(25)14(26)27-8-15(17,18)19/h4-6,9,12H,2-3,7-8H2,1H3 |
| InChIKey | GUUQDXHAYCJHNN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|