C20H19ClF7NO6 — CID 175932562
2,2,2-trifluoroethyl 2-chloro-2-oxoacetate;2,2,2-trifluoroethyl 2-[(5S)-2-(3-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetate (PubChem CID 175932562) has the molecular formula C20H19ClF7NO6 and a molecular weight of 537.81 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-chloro-2-oxoacetate;2,2,2-trifluoroethyl 2-[(5S)-2-(3-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-chloro-2-oxoacetate;2,2,2-trifluoroethyl 2-[(5S)-2-(3-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 175932562 |
| Molecular Formula | C20H19ClF7NO6 |
| Molecular Weight | 537.81 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-chloro-2-oxoacetate;2,2,2-trifluoroethyl 2-[(5S)-2-(3-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetate |
| SMILES | C[C@H]1CCC(c2cccc(F)c2)N(C(=O)C(=O)OCC(F)(F)F)C1.O=C(Cl)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C16H17F4NO3.C4H2ClF3O3/c1-10-5-6-13(11-3-2-4-12(17)7-11)21(8-10)14(22)15(23)24-9-16(18,19)20;5-2(9)3(10)11-1-4(6,7)8/h2-4,7,10,13H,5-6,8-9H2,1H3;1H2/t10-,13?;/m0./s1 |
| InChIKey | JWIRTQHNPKUSFZ-WPYJPOKUSA-N |
| XLogP | 4.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|