C15H20F3N3O3 — CID 169114605
2,2,2-trifluoroethyl 2-[2-(2-ethylpyrazol-3-yl)-5-methylpiperidin-1-yl]-2-oxoacetate (PubChem CID 169114605) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2-(2-ethylpyrazol-3-yl)-5-methylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2-(2-ethylpyrazol-3-yl)-5-methylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169114605 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2-(2-ethylpyrazol-3-yl)-5-methylpiperidin-1-yl]-2-oxoacetate |
| SMILES | CCn1nccc1C1CCC(C)CN1C(=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C15H20F3N3O3/c1-3-21-12(6-7-19-21)11-5-4-10(2)8-20(11)13(22)14(23)24-9-15(16,17)18/h6-7,10-11H,3-5,8-9H2,1-2H3 |
| InChIKey | HWGIFQBMDARZKX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|