C23H24ClF6N3O6 — CID 175932501
2,2,2-trifluoroethyl 2-chloro-2-oxoacetate;2,2,2-trifluoroethyl 2-[(2R,5S)-2-(2-ethylindazol-6-yl)-5-methylpiperidin-1-yl]-2-oxoacetate (PubChem CID 175932501) has the molecular formula C23H24ClF6N3O6 and a molecular weight of 587.90 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-chloro-2-oxoacetate;2,2,2-trifluoroethyl 2-[(2R,5S)-2-(2-ethylindazol-6-yl)-5-methylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-chloro-2-oxoacetate;2,2,2-trifluoroethyl 2-[(2R,5S)-2-(2-ethylindazol-6-yl)-5-methylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 175932501 |
| Molecular Formula | C23H24ClF6N3O6 |
| Molecular Weight | 587.90 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-chloro-2-oxoacetate;2,2,2-trifluoroethyl 2-[(2R,5S)-2-(2-ethylindazol-6-yl)-5-methylpiperidin-1-yl]-2-oxoacetate |
| SMILES | CCn1cc2ccc([C@H]3CC[C@H](C)CN3C(=O)C(=O)OCC(F)(F)F)cc2n1.O=C(Cl)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C19H22F3N3O3.C4H2ClF3O3/c1-3-24-10-14-6-5-13(8-15(14)23-24)16-7-4-12(2)9-25(16)17(26)18(27)28-11-19(20,21)22;5-2(9)3(10)11-1-4(6,7)8/h5-6,8,10,12,16H,3-4,7,9,11H2,1-2H3;1H2/t12-,16+;/m0./s1 |
| InChIKey | IJDRKKXIKAKXSZ-CVHDTDHSSA-N |
| XLogP | 4.32 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.90 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|