C32H42F3N5O5 — CID 175924721
2-[(2S,5R)-4-ethyl-5-methyl-2-phenylpiperazin-1-yl]-2-oxoacetamide;2,2,2-trifluoroethyl 2-[(2S,5R)-4-ethyl-5-methyl-2-phenylpiperazin-1-yl]-2-oxoacetate (PubChem CID 175924721) has the molecular formula C32H42F3N5O5 and a molecular weight of 633.71 g/mol. Its IUPAC name is 2-[(2S,5R)-4-ethyl-5-methyl-2-phenylpiperazin-1-yl]-2-oxoacetamide;2,2,2-trifluoroethyl 2-[(2S,5R)-4-ethyl-5-methyl-2-phenylpiperazin-1-yl]-2-oxoacetate.
| Compound Name | 2-[(2S,5R)-4-ethyl-5-methyl-2-phenylpiperazin-1-yl]-2-oxoacetamide;2,2,2-trifluoroethyl 2-[(2S,5R)-4-ethyl-5-methyl-2-phenylpiperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 175924721 |
| Molecular Formula | C32H42F3N5O5 |
| Molecular Weight | 633.71 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | 2-[(2S,5R)-4-ethyl-5-methyl-2-phenylpiperazin-1-yl]-2-oxoacetamide;2,2,2-trifluoroethyl 2-[(2S,5R)-4-ethyl-5-methyl-2-phenylpiperazin-1-yl]-2-oxoacetate |
| SMILES | CCN1C[C@H](c2ccccc2)N(C(=O)C(=O)OCC(F)(F)F)C[C@H]1C.CCN1C[C@H](c2ccccc2)N(C(=O)C(N)=O)C[C@H]1C |
| InChI | InChI=1S/C17H21F3N2O3.C15H21N3O2/c1-3-21-10-14(13-7-5-4-6-8-13)22(9-12(21)2)15(23)16(24)25-11-17(18,19)20;1-3-17-10-13(12-7-5-4-6-8-12)18(9-11(17)2)15(20)14(16)19/h4-8,12,14H,3,9-11H2,1-2H3;4-8,11,13H,3,9-10H2,1-2H3,(H2,16,19)/t12-,14-;11-,13-/m11/s1 |
| InChIKey | LNSKCGVGHIGPAV-HLUHHZJVSA-N |
| XLogP | 3.15 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|