C24H21F9N2O4 — CID 175924747
1-[(2S,5R)-4-benzyl-5-methyl-2-phenylpiperazin-1-yl]-2,2,2-trifluoroethanone;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 175924747) has the molecular formula C24H21F9N2O4 and a molecular weight of 572.42 g/mol. Its IUPAC name is 1-[(2S,5R)-4-benzyl-5-methyl-2-phenylpiperazin-1-yl]-2,2,2-trifluoroethanone;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | 1-[(2S,5R)-4-benzyl-5-methyl-2-phenylpiperazin-1-yl]-2,2,2-trifluoroethanone;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175924747 |
| Molecular Formula | C24H21F9N2O4 |
| Molecular Weight | 572.42 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 1-[(2S,5R)-4-benzyl-5-methyl-2-phenylpiperazin-1-yl]-2,2,2-trifluoroethanone;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | C[C@@H]1CN(C(=O)C(F)(F)F)[C@@H](c2ccccc2)CN1Cc1ccccc1.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H21F3N2O.C4F6O3/c1-15-12-25(19(26)20(21,22)23)18(17-10-6-3-7-11-17)14-24(15)13-16-8-4-2-5-9-16;5-3(6,7)1(11)13-2(12)4(8,9)10/h2-11,15,18H,12-14H2,1H3;/t15-,18-;/m1./s1 |
| InChIKey | GBDRSGHYOBNNHW-KQKCUOLZSA-N |
| XLogP | 5.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|