C14H19N3O2 — CID 169115432
2-[(2S,5R)-4,5-dimethyl-2-phenylpiperazin-1-yl]-2-oxoacetamide (PubChem CID 169115432) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[(2S,5R)-4,5-dimethyl-2-phenylpiperazin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[(2S,5R)-4,5-dimethyl-2-phenylpiperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 169115432 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[(2S,5R)-4,5-dimethyl-2-phenylpiperazin-1-yl]-2-oxoacetamide |
| SMILES | C[C@@H]1CN(C(=O)C(N)=O)[C@@H](c2ccccc2)CN1C |
| InChI | InChI=1S/C14H19N3O2/c1-10-8-17(14(19)13(15)18)12(9-16(10)2)11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H2,15,18)/t10-,12-/m1/s1 |
| InChIKey | WSOJWTBGGKLVRW-ZYHUDNBSSA-N |
| XLogP | 0.38 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|