C19H23F3N2O3 — CID 169115208
2,2,2-trifluoroethyl 2-[5-methyl-4-(1-methylcyclopropyl)-2-phenylpiperazin-1-yl]-2-oxoacetate (PubChem CID 169115208) has the molecular formula C19H23F3N2O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[5-methyl-4-(1-methylcyclopropyl)-2-phenylpiperazin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[5-methyl-4-(1-methylcyclopropyl)-2-phenylpiperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169115208 |
| Molecular Formula | C19H23F3N2O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[5-methyl-4-(1-methylcyclopropyl)-2-phenylpiperazin-1-yl]-2-oxoacetate |
| SMILES | CC1CN(C(=O)C(=O)OCC(F)(F)F)C(c2ccccc2)CN1C1(C)CC1 |
| InChI | InChI=1S/C19H23F3N2O3/c1-13-10-23(16(25)17(26)27-12-19(20,21)22)15(14-6-4-3-5-7-14)11-24(13)18(2)8-9-18/h3-7,13,15H,8-12H2,1-2H3 |
| InChIKey | IJGUXNARUKUGEN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|