C14H16LiNO3 — CID 164751848
lithium 2-[(2S,5R)-5-methyl-2-phenylpiperidin-1-yl]-2-oxoacetate (PubChem CID 164751848) has the molecular formula C14H16LiNO3 and a molecular weight of 253.23 g/mol. Its IUPAC name is lithium 2-[(2S,5R)-5-methyl-2-phenylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | lithium 2-[(2S,5R)-5-methyl-2-phenylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 164751848 |
| Molecular Formula | C14H16LiNO3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | lithium 2-[(2S,5R)-5-methyl-2-phenylpiperidin-1-yl]-2-oxoacetate |
| SMILES | C[C@@H]1CC[C@@H](c2ccccc2)N(C(=O)C(=O)[O-])C1.[Li+] |
| InChI | InChI=1S/C14H17NO3.Li/c1-10-7-8-12(11-5-3-2-4-6-11)15(9-10)13(16)14(17)18;/h2-6,10,12H,7-9H2,1H3,(H,17,18);/q;+1/p-1/t10-,12+;/m1./s1 |
| InChIKey | CURUSJUSFUWRPL-IYJPBCIQSA-M |
| XLogP | -2.26 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|