About N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide
N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide (PubChem CID 164753441) has the molecular formula C21H26N4O2
and a molecular weight of 366.47 g/mol. Its IUPAC name is N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide.
Molecular Properties
| Compound Name | N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide |
| PubChem CID | 164753441 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide |
| SMILES | Cc1c(NC(=O)C(=O)N2CC(C)CCC2c2ccccc2)cnc(N)c1C |
| InChI | InChI=1S/C21H26N4O2/c1-13-9-10-18(16-7-5-4-6-8-16)25(12-13)21(27)20(26)24-17-11-23-19(22)15(3)14(17)2/h4-8,11,13,18H,9-10,12H2,1-3H3,(H2,22,23)(H,24,26) |
| InChIKey | LMYXXQBKQKRERO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide?
The IUPAC name of N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide (CID 164753441) is N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide.
What is the SMILES notation for N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide?
The canonical SMILES for N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide is Cc1c(NC(=O)C(=O)N2CC(C)CCC2c2ccccc2)cnc(N)c1C.
What is the InChIKey of N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide?
The InChIKey is LMYXXQBKQKRERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O2/c1-13-9-10-18(16-7-5-4-6-8-16)25(12-13)21(27)20(26)24-17-11-23-19(22)15(3)14(17)2/h4-8,11,13,18H,9-10,12H2,1-3H3,(H2,22,23)(H,24,26).
What are the key properties of N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide?
N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide has a molecular weight of 366.47 g/mol, XLogP of 3.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-(5-methyl-2-phenylpiperidin-1-yl)-2-oxoacetamide is sourced from PubChem (CID 164753441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).