C26H34N8O2 — CID 169113669
N-(7-amino-1-methylpyrazolo[5,4-c]pyridin-4-yl)-2-[(2R,5S)-5-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]piperidin-1-yl]-2-oxoacetamide (PubChem CID 169113669) has the molecular formula C26H34N8O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is N-(7-amino-1-methylpyrazolo[5,4-c]pyridin-4-yl)-2-[(2R,5S)-5-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(7-amino-1-methylpyrazolo[5,4-c]pyridin-4-yl)-2-[(2R,5S)-5-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 169113669 |
| Molecular Formula | C26H34N8O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | N-(7-amino-1-methylpyrazolo[5,4-c]pyridin-4-yl)-2-[(2R,5S)-5-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]piperidin-1-yl]-2-oxoacetamide |
| SMILES | C[C@H]1CC[C@H](c2ccc(N3CCN(C)CC3)cc2)N(C(=O)C(=O)Nc2cnc(N)c3c2cnn3C)C1 |
| InChI | InChI=1S/C26H34N8O2/c1-17-4-9-22(18-5-7-19(8-6-18)33-12-10-31(2)11-13-33)34(16-17)26(36)25(35)30-21-15-28-24(27)23-20(21)14-29-32(23)3/h5-8,14-15,17,22H,4,9-13,16H2,1-3H3,(H2,27,28)(H,30,35)/t17-,22+/m0/s1 |
| InChIKey | RKZBFJPEVUGSAZ-HTAPYJJXSA-N |
| XLogP | 2.24 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|