C22H27FN4O2 — CID 164751296
N-(6-amino-5-propan-2-yl-3-pyridinyl)-2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 164751296) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is N-(6-amino-5-propan-2-yl-3-pyridinyl)-2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-propan-2-yl-3-pyridinyl)-2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 164751296 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | N-(6-amino-5-propan-2-yl-3-pyridinyl)-2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | CC(C)c1cc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2ccc(F)cc2)cnc1N |
| InChI | InChI=1S/C22H27FN4O2/c1-13(2)18-10-17(11-25-20(18)24)26-21(28)22(29)27-12-14(3)4-9-19(27)15-5-7-16(23)8-6-15/h5-8,10-11,13-14,19H,4,9,12H2,1-3H3,(H2,24,25)(H,26,28)/t14-,19+/m0/s1 |
| InChIKey | SEQVMGKOYLBYML-IFXJQAMLSA-N |
| XLogP | 3.86 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|