C21H26N4O2 — CID 164752907
N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-[(2R,6R)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 164752907) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-[(2R,6R)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-[(2R,6R)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 164752907 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-(6-amino-4,5-dimethyl-3-pyridinyl)-2-[(2R,6R)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1c(NC(=O)C(=O)N2[C@H](C)CCC[C@@H]2c2ccccc2)cnc(N)c1C |
| InChI | InChI=1S/C21H26N4O2/c1-13-8-7-11-18(16-9-5-4-6-10-16)25(13)21(27)20(26)24-17-12-23-19(22)15(3)14(17)2/h4-6,9-10,12-13,18H,7-8,11H2,1-3H3,(H2,22,23)(H,24,26)/t13-,18-/m1/s1 |
| InChIKey | XYSHOUIPTMVEIE-FZKQIMNGSA-N |
| XLogP | 3.36 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|