C14H17NNaO3- — CID 164753404
sodium;1-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]ethane-1,2-dione;hydroxide (PubChem CID 164753404) has the molecular formula C14H17NNaO3- and a molecular weight of 270.28 g/mol. Its IUPAC name is sodium;1-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]ethane-1,2-dione;hydroxide.
| Compound Name | sodium;1-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]ethane-1,2-dione;hydroxide |
|---|---|
| PubChem CID | 164753404 |
| Molecular Formula | C14H17NNaO3- |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | sodium;1-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]ethane-1,2-dione;hydroxide |
| SMILES | C[C@H]1CCC[C@@H](c2ccccc2)N1C(=O)[C-]=O.[Na+].[OH-] |
| InChI | InChI=1S/C14H16NO2.Na.H2O/c1-11-6-5-9-13(15(11)14(17)10-16)12-7-3-2-4-8-12;;/h2-4,7-8,11,13H,5-6,9H2,1H3;;1H2/q-1;+1;/p-1/t11-,13-;;/m0../s1 |
| InChIKey | HXJOBYXRFRMGHS-JBUFHSOLSA-M |
| XLogP | -0.93 |
| TPSA | 67.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|