C15H20LiNO3 — CID 175470998
lithium;1-(2,3-dimethyl-6-phenylpiperidin-1-yl)ethane-1,2-dione;hydrate (PubChem CID 175470998) has the molecular formula C15H20LiNO3 and a molecular weight of 269.27 g/mol. Its IUPAC name is lithium;1-(2,3-dimethyl-6-phenylpiperidin-1-yl)ethane-1,2-dione;hydrate.
| Compound Name | lithium;1-(2,3-dimethyl-6-phenylpiperidin-1-yl)ethane-1,2-dione;hydrate |
|---|---|
| PubChem CID | 175470998 |
| Molecular Formula | C15H20LiNO3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | lithium;1-(2,3-dimethyl-6-phenylpiperidin-1-yl)ethane-1,2-dione;hydrate |
| SMILES | CC1CCC(c2ccccc2)N(C(=O)[C-]=O)C1C.O.[Li+] |
| InChI | InChI=1S/C15H18NO2.Li.H2O/c1-11-8-9-14(13-6-4-3-5-7-13)16(12(11)2)15(18)10-17;;/h3-7,11-12,14H,8-9H2,1-2H3;;1H2/q-1;+1; |
| InChIKey | GDUOVHIDNUNKFP-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|