C15H18LiNO3 — CID 164753715
lithium 2-(2,3-dimethyl-6-phenylpiperidin-1-yl)-2-oxoacetate (PubChem CID 164753715) has the molecular formula C15H18LiNO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is lithium 2-(2,3-dimethyl-6-phenylpiperidin-1-yl)-2-oxoacetate.
| Compound Name | lithium 2-(2,3-dimethyl-6-phenylpiperidin-1-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 164753715 |
| Molecular Formula | C15H18LiNO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | lithium 2-(2,3-dimethyl-6-phenylpiperidin-1-yl)-2-oxoacetate |
| SMILES | CC1CCC(c2ccccc2)N(C(=O)C(=O)[O-])C1C.[Li+] |
| InChI | InChI=1S/C15H19NO3.Li/c1-10-8-9-13(12-6-4-3-5-7-12)16(11(10)2)14(17)15(18)19;/h3-7,10-11,13H,8-9H2,1-2H3,(H,18,19);/q;+1/p-1 |
| InChIKey | ICRBOCNRLJBOMC-UHFFFAOYSA-M |
| XLogP | -1.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|