C14H17N2O3- — CID 19967950
1-(2-aminoacetyl)-6-phenylpiperidine-2-carboxylate (PubChem CID 19967950) has the molecular formula C14H17N2O3- and a molecular weight of 261.30 g/mol. Its IUPAC name is 1-(2-aminoacetyl)-6-phenylpiperidine-2-carboxylate.
| Compound Name | 1-(2-aminoacetyl)-6-phenylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 19967950 |
| Molecular Formula | C14H17N2O3- |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-(2-aminoacetyl)-6-phenylpiperidine-2-carboxylate |
| SMILES | NCC(=O)N1C(C(=O)[O-])CCCC1c1ccccc1 |
| InChI | InChI=1S/C14H18N2O3/c15-9-13(17)16-11(10-5-2-1-3-6-10)7-4-8-12(16)14(18)19/h1-3,5-6,11-12H,4,7-9,15H2,(H,18,19)/p-1 |
| InChIKey | FRUKFPJTUDPMLX-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |