C22H27NO — CID 40599711
1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 40599711) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 40599711 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO/c1-17-10-9-11-18(2)23(17)22(24)16-21(19-12-5-3-6-13-19)20-14-7-4-8-15-20/h3-8,12-15,17-18,21H,9-11,16H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | UALMAMFREKWKOW-ROUUACIJSA-N |
| XLogP | 5.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |