C16H22N2O2 — CID 110757185
N-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]benzamide (PubChem CID 110757185) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | N-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110757185 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]benzamide |
| SMILES | CC1CCCC(C)N1C(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O2/c1-12-7-6-8-13(2)18(12)15(19)11-17-16(20)14-9-4-3-5-10-14/h3-5,9-10,12-13H,6-8,11H2,1-2H3,(H,17,20) |
| InChIKey | ABHZGGKUTQIVIL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |