C15H21NOS — CID 2355289
1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-phenylsulfanylethanone (PubChem CID 2355289) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-phenylsulfanylethanone.
| Compound Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 2355289 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-phenylsulfanylethanone |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C15H21NOS/c1-12-7-6-8-13(2)16(12)15(17)11-18-14-9-4-3-5-10-14/h3-5,9-10,12-13H,6-8,11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | QBMMWYHVBZEFSZ-STQMWFEESA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |