C21H25N3O2 — CID 138999944
5-methyl-N-[3-(methylcarbamoyl)phenyl]-2-phenylpiperidine-1-carboxamide (PubChem CID 138999944) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-methyl-N-[3-(methylcarbamoyl)phenyl]-2-phenylpiperidine-1-carboxamide.
| Compound Name | 5-methyl-N-[3-(methylcarbamoyl)phenyl]-2-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 138999944 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 5-methyl-N-[3-(methylcarbamoyl)phenyl]-2-phenylpiperidine-1-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)N2CC(C)CCC2c2ccccc2)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-11-12-19(16-7-4-3-5-8-16)24(14-15)21(26)23-18-10-6-9-17(13-18)20(25)22-2/h3-10,13,15,19H,11-12,14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | RBOKANCSFABTFT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |